ChemNet > CAS > 31270-80-1 4-klorofuro[3,2-c]pyridin
31270-80-1 4-klorofuro[3,2-c]pyridin
| produktnavn |
4-klorofuro[3,2-c]pyridin |
| Engelsk navn |
4-chlorofuro[3,2-c]pyridine; |
| Molekylær Formel |
C7H4ClNO |
| Molekylvekt |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
| CAS-nummer |
31270-80-1 |
| Molecular Structure |
![31270-80-1 4-klorofuro[3,2-c]pyridin](https://images-a.chemnet.com/suppliers/chembase/301/121301_1.jpg)
|
| Tetthet |
1.377g/cm3 |
| Smeltepunkt |
40℃ |
| Kokepunkt |
242.806°C at 760 mmHg |
| Brytningsindeks |
1.624 |
| Flammepunktet |
100.646°C |
| Damptrykk |
0.052mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
